C7H15IN2OS2 — CID 90160125
(2S)-3-(tert-butyldisulfanyl)-2-hydrazinylpropanoyl iodide (PubChem CID 90160125) has the molecular formula C7H15IN2OS2 and a molecular weight of 334.25 g/mol. Its IUPAC name is (2S)-3-(tert-butyldisulfanyl)-2-hydrazinylpropanoyl iodide.
| Compound Name | (2S)-3-(tert-butyldisulfanyl)-2-hydrazinylpropanoyl iodide |
|---|---|
| PubChem CID | 90160125 |
| Molecular Formula | C7H15IN2OS2 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | (2S)-3-(tert-butyldisulfanyl)-2-hydrazinylpropanoyl iodide |
| SMILES | CC(C)(C)SSC[C@H](NN)C(=O)I |
| InChI | InChI=1S/C7H15IN2OS2/c1-7(2,3)13-12-4-5(10-9)6(8)11/h5,10H,4,9H2,1-3H3/t5-/m0/s1 |
| InChIKey | APDGPHRUVOFYBP-YFKPBYRVSA-N |
| XLogP | 1.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|