C14H30N4O2S2 — CID 142641960
(2R)-2-amino-3-[[(2R)-2-amino-3-(tert-butylamino)-3-oxopropyl]disulfanyl]-N-tert-butylpropanamide (PubChem CID 142641960) has the molecular formula C14H30N4O2S2 and a molecular weight of 350.55 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2R)-2-amino-3-(tert-butylamino)-3-oxopropyl]disulfanyl]-N-tert-butylpropanamide.
| Compound Name | (2R)-2-amino-3-[[(2R)-2-amino-3-(tert-butylamino)-3-oxopropyl]disulfanyl]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 142641960 |
| Molecular Formula | C14H30N4O2S2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | (2R)-2-amino-3-[[(2R)-2-amino-3-(tert-butylamino)-3-oxopropyl]disulfanyl]-N-tert-butylpropanamide |
| SMILES | CC(C)(C)NC(=O)[C@@H](N)CSSC[C@H](N)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H30N4O2S2/c1-13(2,3)17-11(19)9(15)7-21-22-8-10(16)12(20)18-14(4,5)6/h9-10H,7-8,15-16H2,1-6H3,(H,17,19)(H,18,20)/t9-,10-/m0/s1 |
| InChIKey | VTGSRQPARLZZSQ-UWVGGRQHSA-N |
| XLogP | 0.85 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|