C8H18N4O2S2 — CID 142641958
(2R)-2-amino-3-[[(2R)-2-amino-3-(methylamino)-3-oxopropyl]disulfanyl]-N-methylpropanamide (PubChem CID 142641958) has the molecular formula C8H18N4O2S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2R)-2-amino-3-(methylamino)-3-oxopropyl]disulfanyl]-N-methylpropanamide.
| Compound Name | (2R)-2-amino-3-[[(2R)-2-amino-3-(methylamino)-3-oxopropyl]disulfanyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 142641958 |
| Molecular Formula | C8H18N4O2S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (2R)-2-amino-3-[[(2R)-2-amino-3-(methylamino)-3-oxopropyl]disulfanyl]-N-methylpropanamide |
| SMILES | CNC(=O)[C@@H](N)CSSC[C@H](N)C(=O)NC |
| InChI | InChI=1S/C8H18N4O2S2/c1-11-7(13)5(9)3-15-16-4-6(10)8(14)12-2/h5-6H,3-4,9-10H2,1-2H3,(H,11,13)(H,12,14)/t5-,6-/m0/s1 |
| InChIKey | SHLAJXUBMIXPCG-WDSKDSINSA-N |
| XLogP | -1.49 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|