C9H20N2O — CID 166554166
(2S)-2-amino-N,6-dimethylheptanamide (PubChem CID 166554166) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is (2S)-2-amino-N,6-dimethylheptanamide.
| Compound Name | (2S)-2-amino-N,6-dimethylheptanamide |
|---|---|
| PubChem CID | 166554166 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | (2S)-2-amino-N,6-dimethylheptanamide |
| SMILES | CNC(=O)[C@@H](N)CCCC(C)C |
| InChI | InChI=1S/C9H20N2O/c1-7(2)5-4-6-8(10)9(12)11-3/h7-8H,4-6,10H2,1-3H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | MBFBOCDMFNXGMQ-QMMMGPOBSA-N |
| XLogP | 0.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |