C11H29N3O — CID 142474602
2,6-diamino-N-methylhexanamide;ethane (PubChem CID 142474602) has the molecular formula C11H29N3O and a molecular weight of 219.37 g/mol. Its IUPAC name is 2,6-diamino-N-methylhexanamide;ethane.
| Compound Name | 2,6-diamino-N-methylhexanamide;ethane |
|---|---|
| PubChem CID | 142474602 |
| Molecular Formula | C11H29N3O |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.23 |
| IUPAC Name | 2,6-diamino-N-methylhexanamide;ethane |
| SMILES | CC.CC.CNC(=O)C(N)CCCCN |
| InChI | InChI=1S/C7H17N3O.2C2H6/c1-10-7(11)6(9)4-2-3-5-8;2*1-2/h6H,2-5,8-9H2,1H3,(H,10,11);2*1-2H3 |
| InChIKey | SYFSOCQVMOQCMH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|