C6H11ClN2O — CID 45101850
(2S)-2-amino-4-chloro-N-methylpent-4-enamide (PubChem CID 45101850) has the molecular formula C6H11ClN2O and a molecular weight of 162.62 g/mol. Its IUPAC name is (2S)-2-amino-4-chloro-N-methylpent-4-enamide.
| Compound Name | (2S)-2-amino-4-chloro-N-methylpent-4-enamide |
|---|---|
| PubChem CID | 45101850 |
| Molecular Formula | C6H11ClN2O |
| Molecular Weight | 162.62 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | (2S)-2-amino-4-chloro-N-methylpent-4-enamide |
| SMILES | C=C(Cl)C[C@H](N)C(=O)NC |
| InChI | InChI=1S/C6H11ClN2O/c1-4(7)3-5(8)6(10)9-2/h5H,1,3,8H2,2H3,(H,9,10)/t5-/m0/s1 |
| InChIKey | HWKWBNZWXBELRY-YFKPBYRVSA-N |
| XLogP | 0.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.62 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |