C10H16N2O — CID 144506280
(4Z)-2-amino-4-ethenyl-N-methylhepta-4,6-dienamide (PubChem CID 144506280) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (4Z)-2-amino-4-ethenyl-N-methylhepta-4,6-dienamide.
| Compound Name | (4Z)-2-amino-4-ethenyl-N-methylhepta-4,6-dienamide |
|---|---|
| PubChem CID | 144506280 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (4Z)-2-amino-4-ethenyl-N-methylhepta-4,6-dienamide |
| SMILES | C=C/C=C(\C=C)CC(N)C(=O)NC |
| InChI | InChI=1S/C10H16N2O/c1-4-6-8(5-2)7-9(11)10(13)12-3/h4-6,9H,1-2,7,11H2,3H3,(H,12,13)/b8-6+ |
| InChIKey | SZNHGPYXSKKJET-SOFGYWHQSA-N |
| XLogP | 0.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|