C10H15NOS — CID 142133162
2-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanyl-N-methylacetamide (PubChem CID 142133162) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is 2-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanyl-N-methylacetamide.
| Compound Name | 2-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 142133162 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanyl-N-methylacetamide |
| SMILES | C=C/C=C(\C=C)CSCC(=O)NC |
| InChI | InChI=1S/C10H15NOS/c1-4-6-9(5-2)7-13-8-10(12)11-3/h4-6H,1-2,7-8H2,3H3,(H,11,12)/b9-6+ |
| InChIKey | SOTFJHHYSCHNOI-RMKNXTFCSA-N |
| XLogP | 1.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|