C10H15NO — CID 144680343
N-[(2E)-2-ethenylpenta-2,4-dienyl]propanamide (PubChem CID 144680343) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is N-[(2E)-2-ethenylpenta-2,4-dienyl]propanamide.
| Compound Name | N-[(2E)-2-ethenylpenta-2,4-dienyl]propanamide |
|---|---|
| PubChem CID | 144680343 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-[(2E)-2-ethenylpenta-2,4-dienyl]propanamide |
| SMILES | C=C/C=C(\C=C)CNC(=O)CC |
| InChI | InChI=1S/C10H15NO/c1-4-7-9(5-2)8-11-10(12)6-3/h4-5,7H,1-2,6,8H2,3H3,(H,11,12)/b9-7+ |
| InChIKey | HNANAEJSSRKSDN-VQHVLOKHSA-N |
| XLogP | 1.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|