C10H12N2O — CID 142264688
2-cyano-N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide (PubChem CID 142264688) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-cyano-N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide.
| Compound Name | 2-cyano-N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide |
|---|---|
| PubChem CID | 142264688 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-cyano-N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide |
| SMILES | C=C/C=C(\C=C)CNC(=O)CC#N |
| InChI | InChI=1S/C10H12N2O/c1-3-5-9(4-2)8-12-10(13)6-7-11/h3-5H,1-2,6,8H2,(H,12,13)/b9-5+ |
| InChIKey | UYNHLVLACCKQBI-WEVVVXLNSA-N |
| XLogP | 1.31 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|