C11H17N — CID 142107986
ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile (PubChem CID 142107986) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile.
| Compound Name | ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 142107986 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile |
| SMILES | C=C/C=C(\C=C/C)CC#N.CC |
| InChI | InChI=1S/C9H11N.C2H6/c1-3-5-9(6-4-2)7-8-10;1-2/h3-6H,1,7H2,2H3;1-2H3/b6-4-,9-5+; |
| InChIKey | SJJULFKIGQWBJX-AFPQSWDMSA-N |
| XLogP | 3.61 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|