About ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile
ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile (PubChem CID 142107986) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile.
Molecular Properties
| Compound Name | ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile |
| PubChem CID | 142107986 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile |
| SMILES | C=C/C=C(\C=C/C)CC#N.CC |
| InChI | InChI=1S/C9H11N.C2H6/c1-3-5-9(6-4-2)7-8-10;1-2/h3-6H,1,7H2,2H3;1-2H3/b6-4-,9-5+; |
| InChIKey | SJJULFKIGQWBJX-AFPQSWDMSA-N |
| XLogP | 3.61 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile?
The IUPAC name of ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile (CID 142107986) is ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile.
What is the SMILES notation for ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile?
The canonical SMILES for ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile is C=C/C=C(\C=C/C)CC#N.CC.
What is the InChIKey of ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile?
The InChIKey is SJJULFKIGQWBJX-AFPQSWDMSA-N. The full InChI is InChI=1S/C9H11N.C2H6/c1-3-5-9(6-4-2)7-8-10;1-2/h3-6H,1,7H2,2H3;1-2H3/b6-4-,9-5+;.
What are the key properties of ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile?
ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile has a molecular weight of 163.26 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile is sourced from PubChem (CID 142107986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).