C10H15N — CID 143537599
ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile (PubChem CID 143537599) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile.
| Compound Name | ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 143537599 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile |
| SMILES | C=C/C=C(C#N)\C=C/C.CC |
| InChI | InChI=1S/C8H9N.C2H6/c1-3-5-8(7-9)6-4-2;1-2/h3-6H,1H2,2H3;1-2H3/b6-4-,8-5+; |
| InChIKey | IVCMHZPYVVGWRH-CSXGQTSLSA-N |
| XLogP | 3.22 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|