About ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile
ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile (PubChem CID 143537599) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile.
Molecular Properties
| Compound Name | ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile |
| PubChem CID | 143537599 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile |
| SMILES | C=C/C=C(C#N)\C=C/C.CC |
| InChI | InChI=1S/C8H9N.C2H6/c1-3-5-8(7-9)6-4-2;1-2/h3-6H,1H2,2H3;1-2H3/b6-4-,8-5+; |
| InChIKey | IVCMHZPYVVGWRH-CSXGQTSLSA-N |
| XLogP | 3.22 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile?
The IUPAC name of ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile (CID 143537599) is ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile.
What is the SMILES notation for ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile?
The canonical SMILES for ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile is C=C/C=C(C#N)\C=C/C.CC.
What is the InChIKey of ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile?
The InChIKey is IVCMHZPYVVGWRH-CSXGQTSLSA-N. The full InChI is InChI=1S/C8H9N.C2H6/c1-3-5-8(7-9)6-4-2;1-2/h3-6H,1H2,2H3;1-2H3/b6-4-,8-5+;.
What are the key properties of ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile?
ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile has a molecular weight of 149.24 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile is sourced from PubChem (CID 143537599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).