C8H10N2 — CID 142139467
(2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile (PubChem CID 142139467) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is (2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile.
| Compound Name | (2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 142139467 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | (2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienenitrile |
| SMILES | C=C/C(N)=C(C#N)\C=C/C |
| InChI | InChI=1S/C8H10N2/c1-3-5-7(6-9)8(10)4-2/h3-5H,2,10H2,1H3/b5-3-,8-7- |
| InChIKey | MMRKNIHWYRXVOI-OVRZELKPSA-N |
| XLogP | 1.48 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|