C9H10ClN — CID 163485118
(2Z,4Z)-3-(chloromethyl)-2-ethenylhexa-2,4-dienenitrile (PubChem CID 163485118) has the molecular formula C9H10ClN and a molecular weight of 167.64 g/mol. Its IUPAC name is (2Z,4Z)-3-(chloromethyl)-2-ethenylhexa-2,4-dienenitrile.
| Compound Name | (2Z,4Z)-3-(chloromethyl)-2-ethenylhexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 163485118 |
| Molecular Formula | C9H10ClN |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | (2Z,4Z)-3-(chloromethyl)-2-ethenylhexa-2,4-dienenitrile |
| SMILES | C=C/C(C#N)=C(\C=C/C)CCl |
| InChI | InChI=1S/C9H10ClN/c1-3-5-9(6-10)8(4-2)7-11/h3-5H,2,6H2,1H3/b5-3-,9-8- |
| InChIKey | CHXHPFZNDUKZMK-MLBMHQFOSA-N |
| XLogP | 2.81 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|