C12H15N — CID 143819014
(2E,4Z)-2-ethenyl-3-methyl-4-prop-1-en-2-ylhexa-2,4-dienenitrile (PubChem CID 143819014) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (2E,4Z)-2-ethenyl-3-methyl-4-prop-1-en-2-ylhexa-2,4-dienenitrile.
| Compound Name | (2E,4Z)-2-ethenyl-3-methyl-4-prop-1-en-2-ylhexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 143819014 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (2E,4Z)-2-ethenyl-3-methyl-4-prop-1-en-2-ylhexa-2,4-dienenitrile |
| SMILES | C=C/C(C#N)=C(C)\C(=C/C)C(=C)C |
| InChI | InChI=1S/C12H15N/c1-6-11(8-13)10(5)12(7-2)9(3)4/h6-7H,1,3H2,2,4-5H3/b11-10+,12-7- |
| InChIKey | LETIANSDPMVMND-RFWXHOBXSA-N |
| XLogP | 3.53 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|