About 2-ethenyl-4-methylpenta-2,4-dienenitrile
2-ethenyl-4-methylpenta-2,4-dienenitrile (PubChem CID 123944173) has the molecular formula C8H9N
and a molecular weight of 119.17 g/mol. Its IUPAC name is 2-ethenyl-4-methylpenta-2,4-dienenitrile.
Molecular Properties
| Compound Name | 2-ethenyl-4-methylpenta-2,4-dienenitrile |
| PubChem CID | 123944173 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 2-ethenyl-4-methylpenta-2,4-dienenitrile |
| SMILES | C=CC(C#N)=CC(=C)C |
| InChI | InChI=1S/C8H9N/c1-4-8(6-9)5-7(2)3/h4-5H,1-2H2,3H3 |
| InChIKey | SUIAXAASCYYNAB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-4-methylpenta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-4-methylpenta-2,4-dienenitrile?
The IUPAC name of 2-ethenyl-4-methylpenta-2,4-dienenitrile (CID 123944173) is 2-ethenyl-4-methylpenta-2,4-dienenitrile.
What is the SMILES notation for 2-ethenyl-4-methylpenta-2,4-dienenitrile?
The canonical SMILES for 2-ethenyl-4-methylpenta-2,4-dienenitrile is C=CC(C#N)=CC(=C)C.
What is the InChIKey of 2-ethenyl-4-methylpenta-2,4-dienenitrile?
The InChIKey is SUIAXAASCYYNAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N/c1-4-8(6-9)5-7(2)3/h4-5H,1-2H2,3H3.
What are the key properties of 2-ethenyl-4-methylpenta-2,4-dienenitrile?
2-ethenyl-4-methylpenta-2,4-dienenitrile has a molecular weight of 119.17 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-4-methylpenta-2,4-dienenitrile is sourced from PubChem (CID 123944173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).