C12H16N2 — CID 143322021
ethane;(2E,3E)-2-ethylidene-3-(2-methylprop-2-enylidene)butanedinitrile (PubChem CID 143322021) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is ethane;(2E,3E)-2-ethylidene-3-(2-methylprop-2-enylidene)butanedinitrile.
| Compound Name | ethane;(2E,3E)-2-ethylidene-3-(2-methylprop-2-enylidene)butanedinitrile |
|---|---|
| PubChem CID | 143322021 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | ethane;(2E,3E)-2-ethylidene-3-(2-methylprop-2-enylidene)butanedinitrile |
| SMILES | C=C(C)/C=C(C#N)\C(C#N)=C/C.CC |
| InChI | InChI=1S/C10H10N2.C2H6/c1-4-9(6-11)10(7-12)5-8(2)3;1-2/h4-5H,2H2,1,3H3;1-2H3/b9-4-,10-5-; |
| InChIKey | SJUIFIVXYXFLOW-DRWVTRDWSA-N |
| XLogP | 3.51 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|