C9H14N2 — CID 143876446
(2E)-2-ethenyl-4-methylpenta-2,4-dienenitrile;methanamine (PubChem CID 143876446) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (2E)-2-ethenyl-4-methylpenta-2,4-dienenitrile;methanamine.
| Compound Name | (2E)-2-ethenyl-4-methylpenta-2,4-dienenitrile;methanamine |
|---|---|
| PubChem CID | 143876446 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (2E)-2-ethenyl-4-methylpenta-2,4-dienenitrile;methanamine |
| SMILES | C=C/C(C#N)=C\C(=C)C.CN |
| InChI | InChI=1S/C8H9N.CH5N/c1-4-8(6-9)5-7(2)3;1-2/h4-5H,1-2H2,3H3;2H2,1H3/b8-5+; |
| InChIKey | JRMWJRAGFZCWIO-HAAWTFQLSA-N |
| XLogP | 1.77 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|