C9H10N2O — CID 163488499
N-[(2E,4E)-5-cyanohepta-2,4,6-trien-2-yl]formamide (PubChem CID 163488499) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is N-[(2E,4E)-5-cyanohepta-2,4,6-trien-2-yl]formamide.
| Compound Name | N-[(2E,4E)-5-cyanohepta-2,4,6-trien-2-yl]formamide |
|---|---|
| PubChem CID | 163488499 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | N-[(2E,4E)-5-cyanohepta-2,4,6-trien-2-yl]formamide |
| SMILES | C=C/C(C#N)=C\C=C(/C)NC=O |
| InChI | InChI=1S/C9H10N2O/c1-3-9(6-10)5-4-8(2)11-7-12/h3-5,7H,1H2,2H3,(H,11,12)/b8-4+,9-5+ |
| InChIKey | CKPFOOVPFZGCDS-KBXRYBNXSA-N |
| XLogP | 1.27 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|