C11H15NO2 — CID 157263560
buta-1,3-diene;2-methylprop-2-enenitrile;prop-2-enoic acid (PubChem CID 157263560) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is buta-1,3-diene;2-methylprop-2-enenitrile;prop-2-enoic acid.
| Compound Name | buta-1,3-diene;2-methylprop-2-enenitrile;prop-2-enoic acid |
|---|---|
| PubChem CID | 157263560 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | buta-1,3-diene;2-methylprop-2-enenitrile;prop-2-enoic acid |
| SMILES | C=C(C)C#N.C=CC(=O)O.C=CC=C |
| InChI | InChI=1S/C4H5N.C4H6.C3H4O2/c1-4(2)3-5;1-3-4-2;1-2-3(4)5/h1H2,2H3;3-4H,1-2H2;2H,1H2,(H,4,5) |
| InChIKey | AXSWLIPIEWEGGH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|