About ethene;prop-2-enoic acid;hydrate
ethene;prop-2-enoic acid;hydrate (PubChem CID 174424399) has the molecular formula C5H10O3
and a molecular weight of 118.13 g/mol. Its IUPAC name is ethene;prop-2-enoic acid;hydrate.
Molecular Properties
| Compound Name | ethene;prop-2-enoic acid;hydrate |
| PubChem CID | 174424399 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | ethene;prop-2-enoic acid;hydrate |
| SMILES | C=C.C=CC(=O)O.O |
| InChI | InChI=1S/C3H4O2.C2H4.H2O/c1-2-3(4)5;1-2;/h2H,1H2,(H,4,5);1-2H2;1H2 |
| InChIKey | RCJOTCSINAOEDJ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethene;prop-2-enoic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;prop-2-enoic acid;hydrate?
The IUPAC name of ethene;prop-2-enoic acid;hydrate (CID 174424399) is ethene;prop-2-enoic acid;hydrate.
What is the SMILES notation for ethene;prop-2-enoic acid;hydrate?
The canonical SMILES for ethene;prop-2-enoic acid;hydrate is C=C.C=CC(=O)O.O.
What is the InChIKey of ethene;prop-2-enoic acid;hydrate?
The InChIKey is RCJOTCSINAOEDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.C2H4.H2O/c1-2-3(4)5;1-2;/h2H,1H2,(H,4,5);1-2H2;1H2.
What are the key properties of ethene;prop-2-enoic acid;hydrate?
ethene;prop-2-enoic acid;hydrate has a molecular weight of 118.13 g/mol, XLogP of 0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;prop-2-enoic acid;hydrate is sourced from PubChem (CID 174424399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).