C8H9NO2S — CID 122468637
(2E)-2-ethenyl-4-methylsulfonylpenta-2,4-dienenitrile (PubChem CID 122468637) has the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. Its IUPAC name is (2E)-2-ethenyl-4-methylsulfonylpenta-2,4-dienenitrile.
| Compound Name | (2E)-2-ethenyl-4-methylsulfonylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 122468637 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | (2E)-2-ethenyl-4-methylsulfonylpenta-2,4-dienenitrile |
| SMILES | C=C/C(C#N)=C\C(=C)S(C)(=O)=O |
| InChI | InChI=1S/C8H9NO2S/c1-4-8(6-9)5-7(2)12(3,10)11/h4-5H,1-2H2,3H3/b8-5+ |
| InChIKey | RNXHWOVIVYZUPD-VMPITWQZSA-N |
| XLogP | 1.18 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|