C13H16N2O — CID 143241309
N-[(2E,4E)-5-(2H-pyridin-1-yl)hepta-2,4,6-trien-2-yl]formamide (PubChem CID 143241309) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is N-[(2E,4E)-5-(2H-pyridin-1-yl)hepta-2,4,6-trien-2-yl]formamide.
| Compound Name | N-[(2E,4E)-5-(2H-pyridin-1-yl)hepta-2,4,6-trien-2-yl]formamide |
|---|---|
| PubChem CID | 143241309 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-[(2E,4E)-5-(2H-pyridin-1-yl)hepta-2,4,6-trien-2-yl]formamide |
| SMILES | C=C/C(=C\C=C(/C)NC=O)N1C=CC=CC1 |
| InChI | InChI=1S/C13H16N2O/c1-3-13(8-7-12(2)14-11-16)15-9-5-4-6-10-15/h3-9,11H,1,10H2,2H3,(H,14,16)/b12-7+,13-8+ |
| InChIKey | GHNHRMWDCPJZQE-INOXDZRUSA-N |
| XLogP | 2.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|