C21H33N3O2 — CID 143307505
N-[(2E,4E)-5-(4-amino-2,7-dimethylcyclohepta-1,3,6-trien-1-yl)oxyhepta-2,4,6-trien-2-yl]formamide;N-methylpropan-2-amine (PubChem CID 143307505) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is N-[(2E,4E)-5-(4-amino-2,7-dimethylcyclohepta-1,3,6-trien-1-yl)oxyhepta-2,4,6-trien-2-yl]formamide;N-methylpropan-2-amine.
| Compound Name | N-[(2E,4E)-5-(4-amino-2,7-dimethylcyclohepta-1,3,6-trien-1-yl)oxyhepta-2,4,6-trien-2-yl]formamide;N-methylpropan-2-amine |
|---|---|
| PubChem CID | 143307505 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | N-[(2E,4E)-5-(4-amino-2,7-dimethylcyclohepta-1,3,6-trien-1-yl)oxyhepta-2,4,6-trien-2-yl]formamide;N-methylpropan-2-amine |
| SMILES | C=C/C(=C\C=C(/C)NC=O)OC1=C(C)C=C(N)CC=C1C.CNC(C)C |
| InChI | InChI=1S/C17H22N2O2.C4H11N/c1-5-16(9-7-14(4)19-11-20)21-17-12(2)6-8-15(18)10-13(17)3;1-4(2)5-3/h5-7,9-11H,1,8,18H2,2-4H3,(H,19,20);4-5H,1-3H3/b14-7+,16-9+; |
| InChIKey | HQBDYRBEKMQHSV-DIFKECQVSA-N |
| XLogP | 3.80 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|