About N-formylprop-2-enamide;N-methylformamide
N-formylprop-2-enamide;N-methylformamide (PubChem CID 159760738) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is N-formylprop-2-enamide;N-methylformamide.
Molecular Properties
| Compound Name | N-formylprop-2-enamide;N-methylformamide |
| PubChem CID | 159760738 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | N-formylprop-2-enamide;N-methylformamide |
| SMILES | C=CC(=O)NC=O.CNC=O |
| InChI | InChI=1S/C4H5NO2.C2H5NO/c1-2-4(7)5-3-6;1-3-2-4/h2-3H,1H2,(H,5,6,7);2H,1H3,(H,3,4) |
| InChIKey | NEVPFACDOWQFLW-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-formylprop-2-enamide;N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-formylprop-2-enamide;N-methylformamide?
The IUPAC name of N-formylprop-2-enamide;N-methylformamide (CID 159760738) is N-formylprop-2-enamide;N-methylformamide.
What is the SMILES notation for N-formylprop-2-enamide;N-methylformamide?
The canonical SMILES for N-formylprop-2-enamide;N-methylformamide is C=CC(=O)NC=O.CNC=O.
What is the InChIKey of N-formylprop-2-enamide;N-methylformamide?
The InChIKey is NEVPFACDOWQFLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.C2H5NO/c1-2-4(7)5-3-6;1-3-2-4/h2-3H,1H2,(H,5,6,7);2H,1H3,(H,3,4).
What are the key properties of N-formylprop-2-enamide;N-methylformamide?
N-formylprop-2-enamide;N-methylformamide has a molecular weight of 158.16 g/mol, XLogP of -1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-formylprop-2-enamide;N-methylformamide is sourced from PubChem (CID 159760738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).