About N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one)
N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one) (PubChem CID 88842550) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one).
Molecular Properties
| Compound Name | N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one) |
| PubChem CID | 88842550 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one) |
| SMILES | C=CC=CNC(=O)C=C.CC(C)=O.CC(C)=O |
| InChI | InChI=1S/C7H9NO.2C3H6O/c1-3-5-6-8-7(9)4-2;2*1-3(2)4/h3-6H,1-2H2,(H,8,9);2*1-2H3 |
| InChIKey | GISCPVOOMHAEJZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one)?
The IUPAC name of N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one) (CID 88842550) is N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one).
What is the SMILES notation for N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one)?
The canonical SMILES for N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one) is C=CC=CNC(=O)C=C.CC(C)=O.CC(C)=O.
What is the InChIKey of N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one)?
The InChIKey is GISCPVOOMHAEJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.2C3H6O/c1-3-5-6-8-7(9)4-2;2*1-3(2)4/h3-6H,1-2H2,(H,8,9);2*1-2H3.
What are the key properties of N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one)?
N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one) has a molecular weight of 239.31 g/mol, XLogP of 2.18, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one) is sourced from PubChem (CID 88842550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).