C13H21NO3 — CID 88842550
N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one) (PubChem CID 88842550) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one).
| Compound Name | N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one) |
|---|---|
| PubChem CID | 88842550 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-buta-1,3-dienylprop-2-enamide;bis(propan-2-one) |
| SMILES | C=CC=CNC(=O)C=C.CC(C)=O.CC(C)=O |
| InChI | InChI=1S/C7H9NO.2C3H6O/c1-3-5-6-8-7(9)4-2;2*1-3(2)4/h3-6H,1-2H2,(H,8,9);2*1-2H3 |
| InChIKey | GISCPVOOMHAEJZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|