C8H13NO — CID 89223729
N-[(1E)-buta-1,3-dienyl]-2-methylpropanamide (PubChem CID 89223729) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is N-[(1E)-buta-1,3-dienyl]-2-methylpropanamide.
| Compound Name | N-[(1E)-buta-1,3-dienyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 89223729 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | N-[(1E)-buta-1,3-dienyl]-2-methylpropanamide |
| SMILES | C=C/C=C/NC(=O)C(C)C |
| InChI | InChI=1S/C8H13NO/c1-4-5-6-9-8(10)7(2)3/h4-7H,1H2,2-3H3,(H,9,10)/b6-5+ |
| InChIKey | VSJONKXXYRRKNS-AATRIKPKSA-N |
| XLogP | 1.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|