C14H23N — CID 142049812
N-[(1E)-buta-1,3-dienyl]-5-methylhepta-1,3,6-trien-3-amine;ethane (PubChem CID 142049812) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is N-[(1E)-buta-1,3-dienyl]-5-methylhepta-1,3,6-trien-3-amine;ethane.
| Compound Name | N-[(1E)-buta-1,3-dienyl]-5-methylhepta-1,3,6-trien-3-amine;ethane |
|---|---|
| PubChem CID | 142049812 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N-[(1E)-buta-1,3-dienyl]-5-methylhepta-1,3,6-trien-3-amine;ethane |
| SMILES | C=C/C=C/NC(C=C)=CC(C)C=C.CC |
| InChI | InChI=1S/C12H17N.C2H6/c1-5-8-9-13-12(7-3)10-11(4)6-2;1-2/h5-11,13H,1-3H2,4H3;1-2H3/b9-8+,12-10?; |
| InChIKey | SENIQIPMFVIYDV-IVFXIYIYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|