C12H18 — CID 154197788
9-methylundeca-1,3,7,10-tetraene (PubChem CID 154197788) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is 9-methylundeca-1,3,7,10-tetraene.
| Compound Name | 9-methylundeca-1,3,7,10-tetraene |
|---|---|
| PubChem CID | 154197788 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 9-methylundeca-1,3,7,10-tetraene |
| SMILES | C=CC=CCCC=CC(C)C=C |
| InChI | InChI=1S/C12H18/c1-4-6-7-8-9-10-11-12(3)5-2/h4-7,10-12H,1-2,8-9H2,3H3 |
| InChIKey | CHSSTCIOCPPLKB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|