C9H16 — CID 123442447
3-methylocta-1,4-diene (PubChem CID 123442447) has the molecular formula C9H16 and a molecular weight of 124.23 g/mol. Its IUPAC name is 3-methylocta-1,4-diene.
| Compound Name | 3-methylocta-1,4-diene |
|---|---|
| PubChem CID | 123442447 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | 3-methylocta-1,4-diene |
| SMILES | C=CC(C)C=CCCC |
| InChI | InChI=1S/C9H16/c1-4-6-7-8-9(3)5-2/h5,7-9H,2,4,6H2,1,3H3 |
| InChIKey | GBGBHBSIUKZIDJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|