C11H20 — CID 57098033
3,4-dimethylnona-1,5-diene (PubChem CID 57098033) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is 3,4-dimethylnona-1,5-diene.
| Compound Name | 3,4-dimethylnona-1,5-diene |
|---|---|
| PubChem CID | 57098033 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 3,4-dimethylnona-1,5-diene |
| SMILES | C=CC(C)C(C)C=CCCC |
| InChI | InChI=1S/C11H20/c1-5-7-8-9-11(4)10(3)6-2/h6,8-11H,2,5,7H2,1,3-4H3 |
| InChIKey | XKUZBRIMIFXNKL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|