C10H18 — CID 145064168
(5Z)-3-methylnona-1,5-diene (PubChem CID 145064168) has the molecular formula C10H18 and a molecular weight of 138.25 g/mol. Its IUPAC name is (5Z)-3-methylnona-1,5-diene.
| Compound Name | (5Z)-3-methylnona-1,5-diene |
|---|---|
| PubChem CID | 145064168 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | (5Z)-3-methylnona-1,5-diene |
| SMILES | C=CC(C)C/C=C\CCC |
| InChI | InChI=1S/C10H18/c1-4-6-7-8-9-10(3)5-2/h5,7-8,10H,2,4,6,9H2,1,3H3/b8-7- |
| InChIKey | YBRWWJFYMTYKHH-FPLPWBNLSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|