C10H20O — CID 122413916
(E,2S,3R)-3-methylnon-5-en-2-ol (PubChem CID 122413916) has the molecular formula C10H20O and a molecular weight of 156.27 g/mol. Its IUPAC name is (E,2S,3R)-3-methylnon-5-en-2-ol.
| Compound Name | (E,2S,3R)-3-methylnon-5-en-2-ol |
|---|---|
| PubChem CID | 122413916 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | (E,2S,3R)-3-methylnon-5-en-2-ol |
| SMILES | CCC/C=C/C[C@@H](C)[C@H](C)O |
| InChI | InChI=1S/C10H20O/c1-4-5-6-7-8-9(2)10(3)11/h6-7,9-11H,4-5,8H2,1-3H3/b7-6+/t9-,10+/m1/s1 |
| InChIKey | IHKVEXLKKQQHAD-YJOJJWFDSA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|