About 3-methylundec-5-en-2-ol
3-methylundec-5-en-2-ol (PubChem CID 91383735) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is 3-methylundec-5-en-2-ol.
Molecular Properties
| Compound Name | 3-methylundec-5-en-2-ol |
| PubChem CID | 91383735 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 3-methylundec-5-en-2-ol |
| SMILES | CCCCCC=CCC(C)C(C)O |
| InChI | InChI=1S/C12H24O/c1-4-5-6-7-8-9-10-11(2)12(3)13/h8-9,11-13H,4-7,10H2,1-3H3 |
| InChIKey | FNJKQNMTHCZOGA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylundec-5-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylundec-5-en-2-ol?
The IUPAC name of 3-methylundec-5-en-2-ol (CID 91383735) is 3-methylundec-5-en-2-ol.
What is the SMILES notation for 3-methylundec-5-en-2-ol?
The canonical SMILES for 3-methylundec-5-en-2-ol is CCCCCC=CCC(C)C(C)O.
What is the InChIKey of 3-methylundec-5-en-2-ol?
The InChIKey is FNJKQNMTHCZOGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O/c1-4-5-6-7-8-9-10-11(2)12(3)13/h8-9,11-13H,4-7,10H2,1-3H3.
What are the key properties of 3-methylundec-5-en-2-ol?
3-methylundec-5-en-2-ol has a molecular weight of 184.32 g/mol, XLogP of 3.53, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylundec-5-en-2-ol is sourced from PubChem (CID 91383735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).