C9H18O2 — CID 90781345
(7S)-6-methyloct-3-ene-1,7-diol (PubChem CID 90781345) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is (7S)-6-methyloct-3-ene-1,7-diol.
| Compound Name | (7S)-6-methyloct-3-ene-1,7-diol |
|---|---|
| PubChem CID | 90781345 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (7S)-6-methyloct-3-ene-1,7-diol |
| SMILES | CC(CC=CCCO)[C@H](C)O |
| InChI | InChI=1S/C9H18O2/c1-8(9(2)11)6-4-3-5-7-10/h3-4,8-11H,5-7H2,1-2H3/t8?,9-/m0/s1 |
| InChIKey | PJDUFQFQACMDJT-GKAPJAKFSA-N |
| XLogP | 1.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|