C11H18O2 — CID 156581779
(3E,6S,8E)-undeca-3,8,10-triene-1,6-diol (PubChem CID 156581779) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (3E,6S,8E)-undeca-3,8,10-triene-1,6-diol.
| Compound Name | (3E,6S,8E)-undeca-3,8,10-triene-1,6-diol |
|---|---|
| PubChem CID | 156581779 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (3E,6S,8E)-undeca-3,8,10-triene-1,6-diol |
| SMILES | C=C/C=C/C[C@@H](O)C/C=C/CCO |
| InChI | InChI=1S/C11H18O2/c1-2-3-5-8-11(13)9-6-4-7-10-12/h2-6,11-13H,1,7-10H2/b5-3+,6-4+/t11-/m1/s1 |
| InChIKey | QALVOPBPSAOURX-RHHOKCBPSA-N |
| XLogP | 1.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|