C10H19NO — CID 167004821
(6Z)-1-(methylamino)nona-6,8-dien-4-ol (PubChem CID 167004821) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (6Z)-1-(methylamino)nona-6,8-dien-4-ol.
| Compound Name | (6Z)-1-(methylamino)nona-6,8-dien-4-ol |
|---|---|
| PubChem CID | 167004821 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (6Z)-1-(methylamino)nona-6,8-dien-4-ol |
| SMILES | C=C/C=C\CC(O)CCCNC |
| InChI | InChI=1S/C10H19NO/c1-3-4-5-7-10(12)8-6-9-11-2/h3-5,10-12H,1,6-9H2,2H3/b5-4- |
| InChIKey | VXXLLPBEJBNRRC-PLNGDYQASA-N |
| XLogP | 1.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|