C11H21NO — CID 141148513
(2S,3R,4R,6Z)-4-methyl-2-(methylamino)nona-6,8-dien-3-ol (PubChem CID 141148513) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (2S,3R,4R,6Z)-4-methyl-2-(methylamino)nona-6,8-dien-3-ol.
| Compound Name | (2S,3R,4R,6Z)-4-methyl-2-(methylamino)nona-6,8-dien-3-ol |
|---|---|
| PubChem CID | 141148513 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (2S,3R,4R,6Z)-4-methyl-2-(methylamino)nona-6,8-dien-3-ol |
| SMILES | C=C/C=C\C[C@@H](C)[C@@H](O)[C@H](C)NC |
| InChI | InChI=1S/C11H21NO/c1-5-6-7-8-9(2)11(13)10(3)12-4/h5-7,9-13H,1,8H2,2-4H3/b7-6-/t9-,10+,11-/m1/s1 |
| InChIKey | TZXSVWDAYNCDDM-IYTSYXLSSA-N |
| XLogP | 1.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|