C5H13NO3 — CID 174689462
3-(methylamino)butane-1,1,2-triol (PubChem CID 174689462) has the molecular formula C5H13NO3 and a molecular weight of 135.16 g/mol. Its IUPAC name is 3-(methylamino)butane-1,1,2-triol.
| Compound Name | 3-(methylamino)butane-1,1,2-triol |
|---|---|
| PubChem CID | 174689462 |
| Molecular Formula | C5H13NO3 |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | 3-(methylamino)butane-1,1,2-triol |
| SMILES | CNC(C)C(O)C(O)O |
| InChI | InChI=1S/C5H13NO3/c1-3(6-2)4(7)5(8)9/h3-9H,1-2H3 |
| InChIKey | PZBHFMDOAOLSDI-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|