C4H11NO3 — CID 87504265
3-aminobutane-1,1,2-triol (PubChem CID 87504265) has the molecular formula C4H11NO3 and a molecular weight of 121.14 g/mol. Its IUPAC name is 3-aminobutane-1,1,2-triol.
| Compound Name | 3-aminobutane-1,1,2-triol |
|---|---|
| PubChem CID | 87504265 |
| Molecular Formula | C4H11NO3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | 3-aminobutane-1,1,2-triol |
| SMILES | CC(N)C(O)C(O)O |
| InChI | InChI=1S/C4H11NO3/c1-2(5)3(6)4(7)8/h2-4,6-8H,5H2,1H3 |
| InChIKey | NWLWTEGFENTBKI-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|