C4H10O6 — CID 5238182
butane-1,1,2,3,4,4-hexol (PubChem CID 5238182) has the molecular formula C4H10O6 and a molecular weight of 154.12 g/mol. Its IUPAC name is butane-1,1,2,3,4,4-hexol.
| Compound Name | butane-1,1,2,3,4,4-hexol |
|---|---|
| PubChem CID | 5238182 |
| Molecular Formula | C4H10O6 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | butane-1,1,2,3,4,4-hexol |
| SMILES | OC(O)C(O)C(O)C(O)O |
| InChI | InChI=1S/C4H10O6/c5-1(3(7)8)2(6)4(9)10/h1-10H |
| InChIKey | CJIKPNIRKCLUAL-UHFFFAOYSA-N |
| XLogP | -3.67 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|