About 4-phosphanylbutane-1,1,2,3-tetrol
4-phosphanylbutane-1,1,2,3-tetrol (PubChem CID 19877723) has the molecular formula C4H11O4P
and a molecular weight of 154.10 g/mol. Its IUPAC name is 4-phosphanylbutane-1,1,2,3-tetrol.
Molecular Properties
| Compound Name | 4-phosphanylbutane-1,1,2,3-tetrol |
| PubChem CID | 19877723 |
| Molecular Formula | C4H11O4P |
| Molecular Weight | 154.10 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | 4-phosphanylbutane-1,1,2,3-tetrol |
| SMILES | OC(O)C(O)C(O)CP |
| InChI | InChI=1S/C4H11O4P/c5-2(1-9)3(6)4(7)8/h2-8H,1,9H2 |
| InChIKey | NGBRVAOYEVRLHN-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.10 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-phosphanylbutane-1,1,2,3-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phosphanylbutane-1,1,2,3-tetrol?
The IUPAC name of 4-phosphanylbutane-1,1,2,3-tetrol (CID 19877723) is 4-phosphanylbutane-1,1,2,3-tetrol.
What is the SMILES notation for 4-phosphanylbutane-1,1,2,3-tetrol?
The canonical SMILES for 4-phosphanylbutane-1,1,2,3-tetrol is OC(O)C(O)C(O)CP.
What is the InChIKey of 4-phosphanylbutane-1,1,2,3-tetrol?
The InChIKey is NGBRVAOYEVRLHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11O4P/c5-2(1-9)3(6)4(7)8/h2-8H,1,9H2.
What are the key properties of 4-phosphanylbutane-1,1,2,3-tetrol?
4-phosphanylbutane-1,1,2,3-tetrol has a molecular weight of 154.10 g/mol, XLogP of -2.11, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phosphanylbutane-1,1,2,3-tetrol is sourced from PubChem (CID 19877723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).