(2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid

C4H10NO3P — CID 87416612

IUPAC(2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid
SMILESN[C@H](C(=O)O)[C@H](O)CP
InChIInChI=1S/C4H10NO3P/c5-3(4(7)8)2(6)1-9/h2-3,6H,1,5,9H2,(H,7,8)/t2-,3+/m1/s1
InChIKeyHYCMMKFLOADHOF-GBXIJSLDSA-N
MW151.10 g/mol
LogP-1.37
Rot. Bonds3

About (2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid

(2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid (PubChem CID 87416612) has the molecular formula C4H10NO3P and a molecular weight of 151.10 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid.

Molecular Properties

Compound Name(2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid
PubChem CID87416612
Molecular FormulaC4H10NO3P
Molecular Weight151.10 g/mol
Exact Mass151.04
IUPAC Name(2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid
SMILESN[C@H](C(=O)O)[C@H](O)CP
InChIInChI=1S/C4H10NO3P/c5-3(4(7)8)2(6)1-9/h2-3,6H,1,5,9H2,(H,7,8)/t2-,3+/m1/s1
InChIKeyHYCMMKFLOADHOF-GBXIJSLDSA-N
XLogP-1.37
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500151.10
LogP ≤ 5-1.37
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid?
The IUPAC name of (2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid (CID 87416612) is (2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid.
What is the SMILES notation for (2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid?
The canonical SMILES for (2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid is N[C@H](C(=O)O)[C@H](O)CP.
What is the InChIKey of (2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid?
The InChIKey is HYCMMKFLOADHOF-GBXIJSLDSA-N. The full InChI is InChI=1S/C4H10NO3P/c5-3(4(7)8)2(6)1-9/h2-3,6H,1,5,9H2,(H,7,8)/t2-,3+/m1/s1.
What are the key properties of (2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid?
(2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid has a molecular weight of 151.10 g/mol, XLogP of -1.37, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-amino-3-hydroxy-4-phosphanylbutanoic acid is sourced from PubChem (CID 87416612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).