About 3-phosphanylpropane-1,1,2-triol
3-phosphanylpropane-1,1,2-triol (PubChem CID 22913132) has the molecular formula C3H9O3P
and a molecular weight of 124.08 g/mol. Its IUPAC name is 3-phosphanylpropane-1,1,2-triol.
Molecular Properties
| Compound Name | 3-phosphanylpropane-1,1,2-triol |
| PubChem CID | 22913132 |
| Molecular Formula | C3H9O3P |
| Molecular Weight | 124.08 g/mol |
| Exact Mass | 124.03 |
| IUPAC Name | 3-phosphanylpropane-1,1,2-triol |
| SMILES | OC(O)C(O)CP |
| InChI | InChI=1S/C3H9O3P/c4-2(1-7)3(5)6/h2-6H,1,7H2 |
| InChIKey | KJFMUXFBDPTBCD-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.08 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-phosphanylpropane-1,1,2-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phosphanylpropane-1,1,2-triol?
The IUPAC name of 3-phosphanylpropane-1,1,2-triol (CID 22913132) is 3-phosphanylpropane-1,1,2-triol.
What is the SMILES notation for 3-phosphanylpropane-1,1,2-triol?
The canonical SMILES for 3-phosphanylpropane-1,1,2-triol is OC(O)C(O)CP.
What is the InChIKey of 3-phosphanylpropane-1,1,2-triol?
The InChIKey is KJFMUXFBDPTBCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9O3P/c4-2(1-7)3(5)6/h2-6H,1,7H2.
What are the key properties of 3-phosphanylpropane-1,1,2-triol?
3-phosphanylpropane-1,1,2-triol has a molecular weight of 124.08 g/mol, XLogP of -1.47, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phosphanylpropane-1,1,2-triol is sourced from PubChem (CID 22913132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).