About CID 162331497
CID 162331497 (PubChem CID 162331497) has the molecular formula C4H11LiP
and a molecular weight of 97.05 g/mol.
Molecular Properties
| Compound Name | CID 162331497 |
| PubChem CID | 162331497 |
| Molecular Formula | C4H11LiP |
| Molecular Weight | 97.05 g/mol |
| Exact Mass | 97.08 |
| IUPAC Name | — |
| SMILES | CC(C)CP.[Li] |
| InChI | InChI=1S/C4H11P.Li/c1-4(2)3-5;/h4H,3,5H2,1-2H3; |
| InChIKey | SLMVUOQCGDNWNI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.05 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 162331497 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162331497?
The IUPAC name of CID 162331497 (CID 162331497) is not available.
What is the SMILES notation for CID 162331497?
The canonical SMILES for CID 162331497 is CC(C)CP.[Li].
What is the InChIKey of CID 162331497?
The InChIKey is SLMVUOQCGDNWNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11P.Li/c1-4(2)3-5;/h4H,3,5H2,1-2H3;.
What are the key properties of CID 162331497?
CID 162331497 has a molecular weight of 97.05 g/mol, XLogP of 1.14, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162331497 is sourced from PubChem (CID 162331497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).