About 3-methylbutylphosphane;dihydrochloride
3-methylbutylphosphane;dihydrochloride (PubChem CID 172804723) has the molecular formula C5H15Cl2P
and a molecular weight of 177.05 g/mol. Its IUPAC name is 3-methylbutylphosphane;dihydrochloride.
Molecular Properties
| Compound Name | 3-methylbutylphosphane;dihydrochloride |
| PubChem CID | 172804723 |
| Molecular Formula | C5H15Cl2P |
| Molecular Weight | 177.05 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 3-methylbutylphosphane;dihydrochloride |
| SMILES | CC(C)CCP.Cl.Cl |
| InChI | InChI=1S/C5H13P.2ClH/c1-5(2)3-4-6;;/h5H,3-4,6H2,1-2H3;2*1H |
| InChIKey | RITLUHBLMMIIGI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.05 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutylphosphane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutylphosphane;dihydrochloride?
The IUPAC name of 3-methylbutylphosphane;dihydrochloride (CID 172804723) is 3-methylbutylphosphane;dihydrochloride.
What is the SMILES notation for 3-methylbutylphosphane;dihydrochloride?
The canonical SMILES for 3-methylbutylphosphane;dihydrochloride is CC(C)CCP.Cl.Cl.
What is the InChIKey of 3-methylbutylphosphane;dihydrochloride?
The InChIKey is RITLUHBLMMIIGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13P.2ClH/c1-5(2)3-4-6;;/h5H,3-4,6H2,1-2H3;2*1H.
What are the key properties of 3-methylbutylphosphane;dihydrochloride?
3-methylbutylphosphane;dihydrochloride has a molecular weight of 177.05 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutylphosphane;dihydrochloride is sourced from PubChem (CID 172804723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).