C5H13PS2 — CID 123998649
3,3-bis(methylsulfanyl)propylphosphane (PubChem CID 123998649) has the molecular formula C5H13PS2 and a molecular weight of 168.27 g/mol. Its IUPAC name is 3,3-bis(methylsulfanyl)propylphosphane.
| Compound Name | 3,3-bis(methylsulfanyl)propylphosphane |
|---|---|
| PubChem CID | 123998649 |
| Molecular Formula | C5H13PS2 |
| Molecular Weight | 168.27 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 3,3-bis(methylsulfanyl)propylphosphane |
| SMILES | CSC(CCP)SC |
| InChI | InChI=1S/C5H13PS2/c1-7-5(8-2)3-4-6/h5H,3-4,6H2,1-2H3 |
| InChIKey | QSLKYBCBWPCLGI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|