C7H16S3 — CID 167045986
1,2-bis(ethylsulfanyl)-1-methylsulfanylethane (PubChem CID 167045986) has the molecular formula C7H16S3 and a molecular weight of 196.41 g/mol. Its IUPAC name is 1,2-bis(ethylsulfanyl)-1-methylsulfanylethane.
| Compound Name | 1,2-bis(ethylsulfanyl)-1-methylsulfanylethane |
|---|---|
| PubChem CID | 167045986 |
| Molecular Formula | C7H16S3 |
| Molecular Weight | 196.41 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 1,2-bis(ethylsulfanyl)-1-methylsulfanylethane |
| SMILES | CCSCC(SC)SCC |
| InChI | InChI=1S/C7H16S3/c1-4-9-6-7(8-3)10-5-2/h7H,4-6H2,1-3H3 |
| InChIKey | JATUKLAGELELDN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|