About 4-methylpentylphosphane
4-methylpentylphosphane (PubChem CID 23117374) has the molecular formula C6H15P
and a molecular weight of 118.16 g/mol. Its IUPAC name is 4-methylpentylphosphane.
Molecular Properties
| Compound Name | 4-methylpentylphosphane |
| PubChem CID | 23117374 |
| Molecular Formula | C6H15P |
| Molecular Weight | 118.16 g/mol |
| Exact Mass | 118.09 |
| IUPAC Name | 4-methylpentylphosphane |
| SMILES | CC(C)CCCP |
| InChI | InChI=1S/C6H15P/c1-6(2)4-3-5-7/h6H,3-5,7H2,1-2H3 |
| InChIKey | BJLVXUZGZUNDGE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.16 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentylphosphane?
The IUPAC name of 4-methylpentylphosphane (CID 23117374) is 4-methylpentylphosphane.
What is the SMILES notation for 4-methylpentylphosphane?
The canonical SMILES for 4-methylpentylphosphane is CC(C)CCCP.
What is the InChIKey of 4-methylpentylphosphane?
The InChIKey is BJLVXUZGZUNDGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15P/c1-6(2)4-3-5-7/h6H,3-5,7H2,1-2H3.
What are the key properties of 4-methylpentylphosphane?
4-methylpentylphosphane has a molecular weight of 118.16 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentylphosphane is sourced from PubChem (CID 23117374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).