About 4-methylpentylarsane
4-methylpentylarsane (PubChem CID 173206216) has the molecular formula C6H15As
and a molecular weight of 162.11 g/mol. Its IUPAC name is 4-methylpentylarsane.
Molecular Properties
| Compound Name | 4-methylpentylarsane |
| PubChem CID | 173206216 |
| Molecular Formula | C6H15As |
| Molecular Weight | 162.11 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 4-methylpentylarsane |
| SMILES | CC(C)CCC[AsH2] |
| InChI | InChI=1S/C6H15As/c1-6(2)4-3-5-7/h6H,3-5,7H2,1-2H3 |
| InChIKey | SYGVNWYSTFPSKM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.11 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentylarsane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentylarsane?
The IUPAC name of 4-methylpentylarsane (CID 173206216) is 4-methylpentylarsane.
What is the SMILES notation for 4-methylpentylarsane?
The canonical SMILES for 4-methylpentylarsane is CC(C)CCC[AsH2].
What is the InChIKey of 4-methylpentylarsane?
The InChIKey is SYGVNWYSTFPSKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15As/c1-6(2)4-3-5-7/h6H,3-5,7H2,1-2H3.
What are the key properties of 4-methylpentylarsane?
4-methylpentylarsane has a molecular weight of 162.11 g/mol, XLogP of 1.47, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentylarsane is sourced from PubChem (CID 173206216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).